C20H24N4O2 — CID 70113254
2-(4-hydroxy-3,5-dimethylanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 70113254) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethylanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(4-hydroxy-3,5-dimethylanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70113254 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethylanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCn1c(=O)ccc2cnc(Nc3cc(C)c(O)c(C)c3)nc21 |
| InChI | InChI=1S/C20H24N4O2/c1-4-5-6-9-24-17(25)8-7-15-12-21-20(23-19(15)24)22-16-10-13(2)18(26)14(3)11-16/h7-8,10-12,26H,4-6,9H2,1-3H3,(H,21,22,23) |
| InChIKey | BTYYEHFZIUKJOS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|