C24H31N7O4S — CID 70113362
(1S,2R,3S,4R)-2,3-dihydroxy-N-(2-hydroxyethyl)-4-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxamide (PubChem CID 70113362) has the molecular formula C24H31N7O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is (1S,2R,3S,4R)-2,3-dihydroxy-N-(2-hydroxyethyl)-4-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-2,3-dihydroxy-N-(2-hydroxyethyl)-4-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 70113362 |
| Molecular Formula | C24H31N7O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (1S,2R,3S,4R)-2,3-dihydroxy-N-(2-hydroxyethyl)-4-[7-[(2-phenylcyclopropyl)amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1-carboxamide |
| SMILES | CCCSc1nc(NC2CC2c2ccccc2)c2nnn([C@@H]3C[C@H](C(=O)NCCO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H31N7O4S/c1-2-10-36-24-27-21(26-16-11-14(16)13-6-4-3-5-7-13)18-22(28-24)31(30-29-18)17-12-15(19(33)20(17)34)23(35)25-8-9-32/h3-7,14-17,19-20,32-34H,2,8-12H2,1H3,(H,25,35)(H,26,27,28)/t14?,15-,16?,17+,19+,20-/m0/s1 |
| InChIKey | ZMUKAKQEJJNERV-HXMJNIPZSA-N |
| XLogP | 1.08 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |