C23H27N3O4Si — CID 70113495
5-[12-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 70113495) has the molecular formula C23H27N3O4Si and a molecular weight of 437.57 g/mol. Its IUPAC name is 5-[12-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[12-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70113495 |
| Molecular Formula | C23H27N3O4Si |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 5-[12-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1nc2c(o1)C=Cc1cc(O[Si](C)(C)C(C)(C)C)ccc1C2c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H27N3O4Si/c1-13-25-20-18(29-13)10-7-14-11-15(30-31(5,6)23(2,3)4)8-9-16(14)19(20)17-12-24-22(28)26-21(17)27/h7-12,19H,1-6H3,(H2,24,26,27,28) |
| InChIKey | KLENFSXNUDCNIR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|