C18H15N3O4 — CID 70113606
5-(12-methoxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione (PubChem CID 70113606) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 5-(12-methoxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(12-methoxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70113606 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-(12-methoxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C=Cc1oc(C)nc1C2c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H15N3O4/c1-9-20-16-14(25-9)6-3-10-7-11(24-2)4-5-12(10)15(16)13-8-19-18(23)21-17(13)22/h3-8,15H,1-2H3,(H2,19,21,22,23) |
| InChIKey | TUQSQOQXMCAJMI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |