C13H23N3O6S3 — CID 70113619
(4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 70113619) has the molecular formula C13H23N3O6S3 and a molecular weight of 413.54 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 70113619 |
| Molecular Formula | C13H23N3O6S3 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCN[C@H]1CN(CCOC(C)OC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C13H23N3O6S3/c1-4-15-11-8-16(5-6-22-9(2)21-3)25(19,20)13-10(11)7-12(23-13)24(14,17)18/h7,9,11,15H,4-6,8H2,1-3H3,(H2,14,17,18)/t9?,11-/m0/s1 |
| InChIKey | BLPBVFFIGUFJRC-UMJHXOGRSA-N |
| XLogP | 0.06 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|