C23H20NO4- — CID 7011394
(1S,2R,5R,6S,7R)-2-(2-methylprop-2-enyl)-3-naphthalen-1-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 7011394) has the molecular formula C23H20NO4- and a molecular weight of 374.42 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R)-2-(2-methylprop-2-enyl)-3-naphthalen-1-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1S,2R,5R,6S,7R)-2-(2-methylprop-2-enyl)-3-naphthalen-1-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 7011394 |
| Molecular Formula | C23H20NO4- |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (1S,2R,5R,6S,7R)-2-(2-methylprop-2-enyl)-3-naphthalen-1-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | C=C(C)C[C@H]1N(c2cccc3ccccc23)C(=O)[C@@H]2[C@H](C(=O)[O-])[C@H]3C=C[C@]21O3 |
| InChI | InChI=1S/C23H21NO4/c1-13(2)12-18-23-11-10-17(28-23)19(22(26)27)20(23)21(25)24(18)16-9-5-7-14-6-3-4-8-15(14)16/h3-11,17-20H,1,12H2,2H3,(H,26,27)/p-1/t17-,18-,19-,20+,23-/m1/s1 |
| InChIKey | UNQJGGLNVXXYSR-ISKJSYKVSA-M |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|