About 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride
2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride (PubChem CID 70114160) has the molecular formula C20H20ClN5
and a molecular weight of 365.87 g/mol. Its IUPAC name is 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride |
| PubChem CID | 70114160 |
| Molecular Formula | C20H20ClN5 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride |
| SMILES | Cc1ccc(-c2cn(C)c(CCc3ccc4ncccc4n3)n2)cn1.Cl |
| InChI | InChI=1S/C20H19N5.ClH/c1-14-5-6-15(12-22-14)19-13-25(2)20(24-19)10-8-16-7-9-17-18(23-16)4-3-11-21-17;/h3-7,9,11-13H,8,10H2,1-2H3;1H |
| InChIKey | BOGSNRMSEYRMCG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride?
The IUPAC name of 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride (CID 70114160) is 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride.
What is the SMILES notation for 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride?
The canonical SMILES for 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride is Cc1ccc(-c2cn(C)c(CCc3ccc4ncccc4n3)n2)cn1.Cl.
What is the InChIKey of 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride?
The InChIKey is BOGSNRMSEYRMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5.ClH/c1-14-5-6-15(12-22-14)19-13-25(2)20(24-19)10-8-16-7-9-17-18(23-16)4-3-11-21-17;/h3-7,9,11-13H,8,10H2,1-2H3;1H.
What are the key properties of 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride?
2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride has a molecular weight of 365.87 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1-methyl-4-(6-methyl-3-pyridinyl)imidazol-2-yl]ethyl]-1,5-naphthyridine;hydrochloride is sourced from PubChem (CID 70114160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).