C20H15N3O4S — CID 70114448
methyl 3-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]thiophene-2-carboxylate (PubChem CID 70114448) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl 3-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70114448 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl 3-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1ccc(-c2nc3cccc4c3n2CCNC4=O)o1 |
| InChI | InChI=1S/C20H15N3O4S/c1-26-20(25)17-11(7-10-28-17)14-5-6-15(27-14)18-22-13-4-2-3-12-16(13)23(18)9-8-21-19(12)24/h2-7,10H,8-9H2,1H3,(H,21,24) |
| InChIKey | WPRBOQXWEGWKDM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |