About 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide
4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide (PubChem CID 70114528) has the molecular formula C7H9F3N4O
and a molecular weight of 222.17 g/mol. Its IUPAC name is 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide |
| PubChem CID | 70114528 |
| Molecular Formula | C7H9F3N4O |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1c(N)cnn1CC(F)(F)F |
| InChI | InChI=1S/C7H9F3N4O/c1-12-6(15)5-4(11)2-13-14(5)3-7(8,9)10/h2H,3,11H2,1H3,(H,12,15) |
| InChIKey | UYBTUOJPIXQTBE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide?
The IUPAC name of 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide (CID 70114528) is 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide.
What is the SMILES notation for 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide?
The canonical SMILES for 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide is CNC(=O)c1c(N)cnn1CC(F)(F)F.
What is the InChIKey of 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide?
The InChIKey is UYBTUOJPIXQTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N4O/c1-12-6(15)5-4(11)2-13-14(5)3-7(8,9)10/h2H,3,11H2,1H3,(H,12,15).
What are the key properties of 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide?
4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide has a molecular weight of 222.17 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-methyl-1-(2,2,2-trifluoroethyl)pyrazole-5-carboxamide is sourced from PubChem (CID 70114528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).