C25H29N5O — CID 70114854
8-(cyclohex-3-en-1-ylmethyl)-2-(N-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70114854) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 8-(cyclohex-3-en-1-ylmethyl)-2-(N-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(cyclohex-3-en-1-ylmethyl)-2-(N-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70114854 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 8-(cyclohex-3-en-1-ylmethyl)-2-(N-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(N(c3ccccc3)C3CCNCC3)nc2n1CC1CC=CCC1 |
| InChI | InChI=1S/C25H29N5O/c31-23-12-11-20-17-27-25(28-24(20)29(23)18-19-7-3-1-4-8-19)30(21-9-5-2-6-10-21)22-13-15-26-16-14-22/h1-3,5-6,9-12,17,19,22,26H,4,7-8,13-16,18H2 |
| InChIKey | FOHPXPCOBSZOJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|