About 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol
2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol (PubChem CID 70114971) has the molecular formula C12H28N2O3
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol.
Molecular Properties
| Compound Name | 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol |
| PubChem CID | 70114971 |
| Molecular Formula | C12H28N2O3 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol |
| SMILES | CCC(N)(CC)CO.CCC1(O)CNCCO1 |
| InChI | InChI=1S/C6H13NO2.C6H15NO/c1-2-6(8)5-7-3-4-9-6;1-3-6(7,4-2)5-8/h7-8H,2-5H2,1H3;8H,3-5,7H2,1-2H3 |
| InChIKey | FHQAFVCBXQSMOL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol?
The IUPAC name of 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol (CID 70114971) is 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol.
What is the SMILES notation for 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol?
The canonical SMILES for 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol is CCC(N)(CC)CO.CCC1(O)CNCCO1.
What is the InChIKey of 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol?
The InChIKey is FHQAFVCBXQSMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C6H15NO/c1-2-6(8)5-7-3-4-9-6;1-3-6(7,4-2)5-8/h7-8H,2-5H2,1H3;8H,3-5,7H2,1-2H3.
What are the key properties of 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol?
2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol has a molecular weight of 248.37 g/mol, XLogP of 0.20, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-ethylbutan-1-ol;2-ethylmorpholin-2-ol is sourced from PubChem (CID 70114971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).