C11H13N — CID 70115040
1,2,3,3a,4,4a-hexahydrocyclopenta[f]indole (PubChem CID 70115040) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,2,3,3a,4,4a-hexahydrocyclopenta[f]indole.
| Compound Name | 1,2,3,3a,4,4a-hexahydrocyclopenta[f]indole |
|---|---|
| PubChem CID | 70115040 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,2,3,3a,4,4a-hexahydrocyclopenta[f]indole |
| SMILES | C1=CC2CC3CCNC3=CC2=C1 |
| InChI | InChI=1S/C11H13N/c1-2-8-6-10-4-5-12-11(10)7-9(8)3-1/h1-3,7-8,10,12H,4-6H2 |
| InChIKey | NRBCATNSMFKFOK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |