C15H19N3O5S — CID 70115511
3-[1-(dimethylsulfamoyl)imidazol-2-yl]-4-(2-hydroxyphenyl)butanoic acid (PubChem CID 70115511) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[1-(dimethylsulfamoyl)imidazol-2-yl]-4-(2-hydroxyphenyl)butanoic acid.
| Compound Name | 3-[1-(dimethylsulfamoyl)imidazol-2-yl]-4-(2-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 70115511 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-[1-(dimethylsulfamoyl)imidazol-2-yl]-4-(2-hydroxyphenyl)butanoic acid |
| SMILES | CN(C)S(=O)(=O)n1ccnc1C(CC(=O)O)Cc1ccccc1O |
| InChI | InChI=1S/C15H19N3O5S/c1-17(2)24(22,23)18-8-7-16-15(18)12(10-14(20)21)9-11-5-3-4-6-13(11)19/h3-8,12,19H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | DYYDYVZFQYAXKL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |