C34H43N3O3 — CID 70115526
(3R,4R,5S,6S)-6-benzhydryl-5-[(2,5-dimethoxyphenyl)methylamino]-N,N-diethyl-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 70115526) has the molecular formula C34H43N3O3 and a molecular weight of 541.74 g/mol. Its IUPAC name is (3R,4R,5S,6S)-6-benzhydryl-5-[(2,5-dimethoxyphenyl)methylamino]-N,N-diethyl-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3R,4R,5S,6S)-6-benzhydryl-5-[(2,5-dimethoxyphenyl)methylamino]-N,N-diethyl-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 70115526 |
| Molecular Formula | C34H43N3O3 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | (3R,4R,5S,6S)-6-benzhydryl-5-[(2,5-dimethoxyphenyl)methylamino]-N,N-diethyl-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CN2CC[C@H]1[C@H](NCc1cc(OC)ccc1OC)[C@@H]2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H43N3O3/c1-5-36(6-2)34(38)29-23-37-20-19-28(29)32(35-22-26-21-27(39-3)17-18-30(26)40-4)33(37)31(24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-18,21,28-29,31-33,35H,5-6,19-20,22-23H2,1-4H3/t28-,29+,32+,33+/m1/s1 |
| InChIKey | BXCXPWYLAUEXBY-CLGPCEASSA-N |
| XLogP | 5.18 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |