About 5-piperidin-4-yl-1,2-thiazole
5-piperidin-4-yl-1,2-thiazole (PubChem CID 70115707) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 5-piperidin-4-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 5-piperidin-4-yl-1,2-thiazole |
| PubChem CID | 70115707 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 5-piperidin-4-yl-1,2-thiazole |
| SMILES | c1cc(C2CCNCC2)sn1 |
| InChI | InChI=1S/C8H12N2S/c1-4-9-5-2-7(1)8-3-6-10-11-8/h3,6-7,9H,1-2,4-5H2 |
| InChIKey | BXYVHEYFUXHYPZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-piperidin-4-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yl-1,2-thiazole?
The IUPAC name of 5-piperidin-4-yl-1,2-thiazole (CID 70115707) is 5-piperidin-4-yl-1,2-thiazole.
What is the SMILES notation for 5-piperidin-4-yl-1,2-thiazole?
The canonical SMILES for 5-piperidin-4-yl-1,2-thiazole is c1cc(C2CCNCC2)sn1.
What is the InChIKey of 5-piperidin-4-yl-1,2-thiazole?
The InChIKey is BXYVHEYFUXHYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-4-9-5-2-7(1)8-3-6-10-11-8/h3,6-7,9H,1-2,4-5H2.
What are the key properties of 5-piperidin-4-yl-1,2-thiazole?
5-piperidin-4-yl-1,2-thiazole has a molecular weight of 168.26 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yl-1,2-thiazole is sourced from PubChem (CID 70115707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).