C8H12N2S — CID 70115707
5-piperidin-4-yl-1,2-thiazole (PubChem CID 70115707) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 5-piperidin-4-yl-1,2-thiazole.
| Compound Name | 5-piperidin-4-yl-1,2-thiazole |
|---|---|
| PubChem CID | 70115707 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 5-piperidin-4-yl-1,2-thiazole |
| SMILES | c1cc(C2CCNCC2)sn1 |
| InChI | InChI=1S/C8H12N2S/c1-4-9-5-2-7(1)8-3-6-10-11-8/h3,6-7,9H,1-2,4-5H2 |
| InChIKey | BXYVHEYFUXHYPZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |