C32H42O5 — CID 70115782
1-(2-hydroxy-7,7-dimethyl-6-phenoxyoct-4-ynoxy)-7,7-dimethyl-6-phenoxyoct-4-yn-2-ol (PubChem CID 70115782) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is 1-(2-hydroxy-7,7-dimethyl-6-phenoxyoct-4-ynoxy)-7,7-dimethyl-6-phenoxyoct-4-yn-2-ol.
| Compound Name | 1-(2-hydroxy-7,7-dimethyl-6-phenoxyoct-4-ynoxy)-7,7-dimethyl-6-phenoxyoct-4-yn-2-ol |
|---|---|
| PubChem CID | 70115782 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 1-(2-hydroxy-7,7-dimethyl-6-phenoxyoct-4-ynoxy)-7,7-dimethyl-6-phenoxyoct-4-yn-2-ol |
| SMILES | CC(C)(C)C(C#CCC(O)COCC(O)CC#CC(Oc1ccccc1)C(C)(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C32H42O5/c1-31(2,3)29(36-27-17-9-7-10-18-27)21-13-15-25(33)23-35-24-26(34)16-14-22-30(32(4,5)6)37-28-19-11-8-12-20-28/h7-12,17-20,25-26,29-30,33-34H,15-16,23-24H2,1-6H3 |
| InChIKey | NDTJODLAYRGTDW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|