C22H39NO3 — CID 70116093
7-[(1S,2S,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]-N,N-dimethylhept-5-enamide (PubChem CID 70116093) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is 7-[(1S,2S,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]-N,N-dimethylhept-5-enamide.
| Compound Name | 7-[(1S,2S,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]-N,N-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 70116093 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | 7-[(1S,2S,5R)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]-N,N-dimethylhept-5-enamide |
| SMILES | CN(C)C(=O)CCCC=CC[C@@H]1[C@@H](O)CC[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C22H39NO3/c1-23(2)22(26)15-11-7-6-10-14-20-19(16-17-21(20)25)13-9-5-3-4-8-12-18-24/h6,9-10,13,19-21,24-25H,3-5,7-8,11-12,14-18H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | RZERPRPFKGLAIW-ACRUOGEOSA-N |
| XLogP | 4.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|