C23H38F2O — CID 70116305
2,2-difluoro-3-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydropyran (PubChem CID 70116305) has the molecular formula C23H38F2O and a molecular weight of 368.55 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydropyran.
| Compound Name | 2,2-difluoro-3-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydropyran |
|---|---|
| PubChem CID | 70116305 |
| Molecular Formula | C23H38F2O |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 2,2-difluoro-3-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydropyran |
| SMILES | CCCCCC1CCC(C2CCC(C3=CCC(C)C(F)(F)O3)CC2)CC1 |
| InChI | InChI=1S/C23H38F2O/c1-3-4-5-6-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-7-17(2)23(24,25)26-22/h16-21H,3-15H2,1-2H3 |
| InChIKey | WBOXMXNPIJHEDD-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|