C22H24N2O3S — CID 70116801
(4S)-4-benzyl-3-[(3R,4R)-1-prop-2-enyl-4-thiophen-3-ylpyrrolidine-3-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 70116801) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R,4R)-1-prop-2-enyl-4-thiophen-3-ylpyrrolidine-3-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R,4R)-1-prop-2-enyl-4-thiophen-3-ylpyrrolidine-3-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70116801 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R,4R)-1-prop-2-enyl-4-thiophen-3-ylpyrrolidine-3-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCN1C[C@H](C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C22H24N2O3S/c1-2-9-23-12-19(17-8-10-28-15-17)20(13-23)21(25)24-18(14-27-22(24)26)11-16-6-4-3-5-7-16/h2-8,10,15,18-20H,1,9,11-14H2/t18-,19-,20-/m0/s1 |
| InChIKey | LKSVWNFGXRCOFL-UFYCRDLUSA-N |
| XLogP | 3.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|