About 3,3-diaminocyclohexa-1,5-dien-1-ol
3,3-diaminocyclohexa-1,5-dien-1-ol (PubChem CID 70116897) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 3,3-diaminocyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 3,3-diaminocyclohexa-1,5-dien-1-ol |
| PubChem CID | 70116897 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 3,3-diaminocyclohexa-1,5-dien-1-ol |
| SMILES | NC1(N)C=C(O)C=CC1 |
| InChI | InChI=1S/C6H10N2O/c7-6(8)3-1-2-5(9)4-6/h1-2,4,9H,3,7-8H2 |
| InChIKey | TYYMEXDIINHITH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diaminocyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diaminocyclohexa-1,5-dien-1-ol?
The IUPAC name of 3,3-diaminocyclohexa-1,5-dien-1-ol (CID 70116897) is 3,3-diaminocyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 3,3-diaminocyclohexa-1,5-dien-1-ol?
The canonical SMILES for 3,3-diaminocyclohexa-1,5-dien-1-ol is NC1(N)C=C(O)C=CC1.
What is the InChIKey of 3,3-diaminocyclohexa-1,5-dien-1-ol?
The InChIKey is TYYMEXDIINHITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c7-6(8)3-1-2-5(9)4-6/h1-2,4,9H,3,7-8H2.
What are the key properties of 3,3-diaminocyclohexa-1,5-dien-1-ol?
3,3-diaminocyclohexa-1,5-dien-1-ol has a molecular weight of 126.16 g/mol, XLogP of 0.00, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diaminocyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 70116897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).