C29H43NO2Si — CID 70117060
2-[1-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenylethyl]-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol (PubChem CID 70117060) has the molecular formula C29H43NO2Si and a molecular weight of 465.75 g/mol. Its IUPAC name is 2-[1-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenylethyl]-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol.
| Compound Name | 2-[1-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenylethyl]-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 70117060 |
| Molecular Formula | C29H43NO2Si |
| Molecular Weight | 465.75 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 2-[1-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenylethyl]-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCC(c1ccccc1)N1CC=CCC1CC(O)c1ccccc1 |
| InChI | InChI=1S/C29H43NO2Si/c1-23(2)29(3,4)33(5,6)32-22-27(24-15-9-7-10-16-24)30-20-14-13-19-26(30)21-28(31)25-17-11-8-12-18-25/h7-18,23,26-28,31H,19-22H2,1-6H3 |
| InChIKey | SMVXPHKUTUKJCE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|