C11H8N4O3 — CID 70117113
1-phenyl-7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 70117113) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-phenyl-7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 1-phenyl-7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 70117113 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-phenyl-7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | O=c1[nH]c2[nH]c(=O)n(-c3ccccc3)c(=O)c2[nH]1 |
| InChI | InChI=1S/C11H8N4O3/c16-9-7-8(13-10(17)12-7)14-11(18)15(9)6-4-2-1-3-5-6/h1-5H,(H,14,18)(H2,12,13,17) |
| InChIKey | MPKRXENUURLWTO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |