C27H33FN6O3 — CID 70117625
2-[4-[[3-[4-[[4-(2-fluorophenyl)piperazin-1-yl]iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 70117625) has the molecular formula C27H33FN6O3 and a molecular weight of 508.60 g/mol. Its IUPAC name is 2-[4-[[3-[4-[[4-(2-fluorophenyl)piperazin-1-yl]iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[[4-(2-fluorophenyl)piperazin-1-yl]iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70117625 |
| Molecular Formula | C27H33FN6O3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[4-[[3-[4-[[4-(2-fluorophenyl)piperazin-1-yl]iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC2CC(c3ccc(C=NN4CCN(c5ccccc5F)CC4)cc3)=NO2)CC1 |
| InChI | InChI=1S/C27H33FN6O3/c28-24-3-1-2-4-26(24)33-13-15-34(16-14-33)29-18-21-5-7-22(8-6-21)25-17-23(37-30-25)19-31-9-11-32(12-10-31)20-27(35)36/h1-8,18,23H,9-17,19-20H2,(H,35,36) |
| InChIKey | XJDCXZXFIIXLQU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|