C9H10ClNO — CID 70117710
7-chloro-2,3,4a,8a-tetrahydro-1H-quinolin-4-one (PubChem CID 70117710) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 7-chloro-2,3,4a,8a-tetrahydro-1H-quinolin-4-one.
| Compound Name | 7-chloro-2,3,4a,8a-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 70117710 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 7-chloro-2,3,4a,8a-tetrahydro-1H-quinolin-4-one |
| SMILES | O=C1CCNC2C=C(Cl)C=CC12 |
| InChI | InChI=1S/C9H10ClNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-2,5,7-8,11H,3-4H2 |
| InChIKey | JRPVMQUVOCTXRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |