About azane;1,1'-biphenyl;2H-triazole
azane;1,1'-biphenyl;2H-triazole (PubChem CID 70118155) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is azane;1,1'-biphenyl;2H-triazole.
Molecular Properties
| Compound Name | azane;1,1'-biphenyl;2H-triazole |
| PubChem CID | 70118155 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | azane;1,1'-biphenyl;2H-triazole |
| SMILES | N.c1ccc(-c2ccccc2)cc1.c1cn[nH]n1 |
| InChI | InChI=1S/C12H10.C2H3N3.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-5-3-1;/h1-10H;1-2H,(H,3,4,5);1H3 |
| InChIKey | FZNPJAUCRNZTIY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1,1'-biphenyl;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1'-biphenyl;2H-triazole?
The IUPAC name of azane;1,1'-biphenyl;2H-triazole (CID 70118155) is azane;1,1'-biphenyl;2H-triazole.
What is the SMILES notation for azane;1,1'-biphenyl;2H-triazole?
The canonical SMILES for azane;1,1'-biphenyl;2H-triazole is N.c1ccc(-c2ccccc2)cc1.c1cn[nH]n1.
What is the InChIKey of azane;1,1'-biphenyl;2H-triazole?
The InChIKey is FZNPJAUCRNZTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H3N3.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-5-3-1;/h1-10H;1-2H,(H,3,4,5);1H3.
What are the key properties of azane;1,1'-biphenyl;2H-triazole?
azane;1,1'-biphenyl;2H-triazole has a molecular weight of 240.31 g/mol, XLogP of 3.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1'-biphenyl;2H-triazole is sourced from PubChem (CID 70118155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).