C27H36Cl2N2OS — CID 70118280
1-[[1-[(2,4-dichlorophenyl)methyl]-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-[(2S)-2-methoxypent-4-enyl]piperidine (PubChem CID 70118280) has the molecular formula C27H36Cl2N2OS and a molecular weight of 507.57 g/mol. Its IUPAC name is 1-[[1-[(2,4-dichlorophenyl)methyl]-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-[(2S)-2-methoxypent-4-enyl]piperidine.
| Compound Name | 1-[[1-[(2,4-dichlorophenyl)methyl]-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-[(2S)-2-methoxypent-4-enyl]piperidine |
|---|---|
| PubChem CID | 70118280 |
| Molecular Formula | C27H36Cl2N2OS |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-[[1-[(2,4-dichlorophenyl)methyl]-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-[(2S)-2-methoxypent-4-enyl]piperidine |
| SMILES | C=CC[C@@H](CC1CCN(CC2CN(Cc3ccc(Cl)cc3Cl)CC2c2ccsc2)CC1)OC |
| InChI | InChI=1S/C27H36Cl2N2OS/c1-3-4-25(32-2)13-20-7-10-30(11-8-20)16-23-17-31(18-26(23)22-9-12-33-19-22)15-21-5-6-24(28)14-27(21)29/h3,5-6,9,12,14,19-20,23,25-26H,1,4,7-8,10-11,13,15-18H2,2H3/t23?,25-,26?/m0/s1 |
| InChIKey | GOJNLWMLMOZGOM-DHWVBAGJSA-N |
| XLogP | 6.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|