C16H16F3N3O4 — CID 70118290
methyl 4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 70118290) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is methyl 4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70118290 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | methyl 4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)N1CCc2[nH]cnc2C1c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H15N3O2.C2HF3O2/c1-19-14(18)17-8-7-11-12(16-9-15-11)13(17)10-5-3-2-4-6-10;3-2(4,5)1(6)7/h2-6,9,13H,7-8H2,1H3,(H,15,16);(H,6,7) |
| InChIKey | ZWUYVOJYTZJJBP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |