About ethyl 2H-1,3-thiazole-3-carboxylate
ethyl 2H-1,3-thiazole-3-carboxylate (PubChem CID 70119022) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is ethyl 2H-1,3-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2H-1,3-thiazole-3-carboxylate |
| PubChem CID | 70119022 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | ethyl 2H-1,3-thiazole-3-carboxylate |
| SMILES | CCOC(=O)N1C=CSC1 |
| InChI | InChI=1S/C6H9NO2S/c1-2-9-6(8)7-3-4-10-5-7/h3-4H,2,5H2,1H3 |
| InChIKey | VKHOLDVWTIPRLS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2H-1,3-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2H-1,3-thiazole-3-carboxylate?
The IUPAC name of ethyl 2H-1,3-thiazole-3-carboxylate (CID 70119022) is ethyl 2H-1,3-thiazole-3-carboxylate.
What is the SMILES notation for ethyl 2H-1,3-thiazole-3-carboxylate?
The canonical SMILES for ethyl 2H-1,3-thiazole-3-carboxylate is CCOC(=O)N1C=CSC1.
What is the InChIKey of ethyl 2H-1,3-thiazole-3-carboxylate?
The InChIKey is VKHOLDVWTIPRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-2-9-6(8)7-3-4-10-5-7/h3-4H,2,5H2,1H3.
What are the key properties of ethyl 2H-1,3-thiazole-3-carboxylate?
ethyl 2H-1,3-thiazole-3-carboxylate has a molecular weight of 159.21 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2H-1,3-thiazole-3-carboxylate is sourced from PubChem (CID 70119022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).