C28H34FN5O3 — CID 70119037
2-[4-[[3-[4-[2-(2-fluorophenyl)piperazine-1-carboximidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-1-yl]acetic acid (PubChem CID 70119037) has the molecular formula C28H34FN5O3 and a molecular weight of 507.61 g/mol. Its IUPAC name is 2-[4-[[3-[4-[2-(2-fluorophenyl)piperazine-1-carboximidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[2-(2-fluorophenyl)piperazine-1-carboximidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70119037 |
| Molecular Formula | C28H34FN5O3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-[4-[[3-[4-[2-(2-fluorophenyl)piperazine-1-carboximidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-1-yl]acetic acid |
| SMILES | [H]/N=C(\c1ccc(C2=NOC(CC3CCN(CC(=O)O)CC3)C2)cc1)N1CCNCC1c1ccccc1F |
| InChI | InChI=1S/C28H34FN5O3/c29-24-4-2-1-3-23(24)26-17-31-11-14-34(26)28(30)21-7-5-20(6-8-21)25-16-22(37-32-25)15-19-9-12-33(13-10-19)18-27(35)36/h1-8,19,22,26,30-31H,9-18H2,(H,35,36)/b30-28+ |
| InChIKey | YMLFHRAVBCISLU-SJCQXOIGSA-N |
| XLogP | 3.48 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|