C13H21N3O3 — CID 70119308
2-methoxyethyl 4-propyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 70119308) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-methoxyethyl 4-propyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-propyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70119308 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-methoxyethyl 4-propyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | CCCC1c2nc[nH]c2CCN1C(=O)OCCOC |
| InChI | InChI=1S/C13H21N3O3/c1-3-4-11-12-10(14-9-15-12)5-6-16(11)13(17)19-8-7-18-2/h9,11H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | FDLNIZVQYOIWEA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|