About 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid
2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid (PubChem CID 70119473) has the molecular formula C15H24O9
and a molecular weight of 348.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid |
| PubChem CID | 70119473 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid |
| SMILES | CC1(C)CC(=O)C=C(C(=O)O)O1.COCCOCCOCC(=O)O |
| InChI | InChI=1S/C8H10O4.C7H14O5/c1-8(2)4-5(9)3-6(12-8)7(10)11;1-10-2-3-11-4-5-12-6-7(8)9/h3H,4H2,1-2H3,(H,10,11);2-6H2,1H3,(H,8,9) |
| InChIKey | CTYWZLLQZZSDBW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid?
The IUPAC name of 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid (CID 70119473) is 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid.
What is the SMILES notation for 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid?
The canonical SMILES for 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid is CC1(C)CC(=O)C=C(C(=O)O)O1.COCCOCCOCC(=O)O.
What is the InChIKey of 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid?
The InChIKey is CTYWZLLQZZSDBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C7H14O5/c1-8(2)4-5(9)3-6(12-8)7(10)11;1-10-2-3-11-4-5-12-6-7(8)9/h3H,4H2,1-2H3,(H,10,11);2-6H2,1H3,(H,8,9).
What are the key properties of 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid?
2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid has a molecular weight of 348.35 g/mol, XLogP of 0.47, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylic acid;2-[2-(2-methoxyethoxy)ethoxy]acetic acid is sourced from PubChem (CID 70119473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).