About 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine
1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine (PubChem CID 70120820) has the molecular formula C28H45FN6
and a molecular weight of 484.71 g/mol. Its IUPAC name is 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine.
Molecular Properties
| Compound Name | 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine |
| PubChem CID | 70120820 |
| Molecular Formula | C28H45FN6 |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine |
| SMILES | CNC1CCN(C)CC1.Fc1ccc(N2CCNCC2)cc1.NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C11H16N2.C10H13FN2.C7H16N2/c12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;1-8-7-3-5-9(2)6-4-7/h1-5,11H,6-9,12H2;1-4,12H,5-8H2;7-8H,3-6H2,1-2H3 |
| InChIKey | DDZPWWVYEIISGZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine?
The IUPAC name of 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine (CID 70120820) is 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine.
What is the SMILES notation for 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine?
The canonical SMILES for 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine is CNC1CCN(C)CC1.Fc1ccc(N2CCNCC2)cc1.NC1CCN(Cc2ccccc2)C1.
What is the InChIKey of 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine?
The InChIKey is DDZPWWVYEIISGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C10H13FN2.C7H16N2/c12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;1-8-7-3-5-9(2)6-4-7/h1-5,11H,6-9,12H2;1-4,12H,5-8H2;7-8H,3-6H2,1-2H3.
What are the key properties of 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine?
1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine has a molecular weight of 484.71 g/mol, XLogP of 2.75, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrolidin-3-amine;N,1-dimethylpiperidin-4-amine;1-(4-fluorophenyl)piperazine is sourced from PubChem (CID 70120820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).