C12H17N3O2 — CID 70121073
prop-2-enyl 4-ethyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 70121073) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is prop-2-enyl 4-ethyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | prop-2-enyl 4-ethyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70121073 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | prop-2-enyl 4-ethyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | C=CCOC(=O)N1CCc2[nH]cnc2C1CC |
| InChI | InChI=1S/C12H17N3O2/c1-3-7-17-12(16)15-6-5-9-11(10(15)4-2)14-8-13-9/h3,8,10H,1,4-7H2,2H3,(H,13,14) |
| InChIKey | UJSFQUZZKWDKDV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|