C27H42O3 — CID 70121570
[(8R,9S,10R,13S,14S,17S)-2,2,13-trimethyl-3-oxo-1,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate (PubChem CID 70121570) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-2,2,13-trimethyl-3-oxo-1,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-2,2,13-trimethyl-3-oxo-1,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate |
|---|---|
| PubChem CID | 70121570 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-2,2,13-trimethyl-3-oxo-1,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(C)(C)C[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-5-6-7-8-9-25(29)30-24-13-12-22-20-11-10-18-16-23(28)26(2,3)17-21(18)19(20)14-15-27(22,24)4/h16,19-22,24H,5-15,17H2,1-4H3/t19-,20+,21-,22-,24-,27-/m0/s1 |
| InChIKey | CUDOPUUSUDFQLQ-KPPSHLBDSA-N |
| XLogP | 6.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|