C22H14O5 — CID 70122105
2-(5-carboxynaphthalen-1-yl)-4-hydroxynaphthalene-1-carboxylic acid (PubChem CID 70122105) has the molecular formula C22H14O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-(5-carboxynaphthalen-1-yl)-4-hydroxynaphthalene-1-carboxylic acid.
| Compound Name | 2-(5-carboxynaphthalen-1-yl)-4-hydroxynaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 70122105 |
| Molecular Formula | C22H14O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-(5-carboxynaphthalen-1-yl)-4-hydroxynaphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c(-c3cc(O)c4ccccc4c3C(=O)O)cccc12 |
| InChI | InChI=1S/C22H14O5/c23-19-11-18(20(22(26)27)16-6-2-1-5-15(16)19)14-9-3-8-13-12(14)7-4-10-17(13)21(24)25/h1-11,23H,(H,24,25)(H,26,27) |
| InChIKey | ATVLXNRGKFXIEO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |