About 2H-pyrrolo[2,3-i][1,5]benzothiazepine
2H-pyrrolo[2,3-i][1,5]benzothiazepine (PubChem CID 70122398) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 2H-pyrrolo[2,3-i][1,5]benzothiazepine.
Molecular Properties
| Compound Name | 2H-pyrrolo[2,3-i][1,5]benzothiazepine |
| PubChem CID | 70122398 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2H-pyrrolo[2,3-i][1,5]benzothiazepine |
| SMILES | C1=CN=c2ccc3c(c2SC1)C=CN=3 |
| InChI | InChI=1S/C11H8N2S/c1-5-12-10-3-2-9-8(4-6-13-9)11(10)14-7-1/h1-6H,7H2 |
| InChIKey | VVVYSWJCMCDUMN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrrolo[2,3-i][1,5]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[2,3-i][1,5]benzothiazepine?
The IUPAC name of 2H-pyrrolo[2,3-i][1,5]benzothiazepine (CID 70122398) is 2H-pyrrolo[2,3-i][1,5]benzothiazepine.
What is the SMILES notation for 2H-pyrrolo[2,3-i][1,5]benzothiazepine?
The canonical SMILES for 2H-pyrrolo[2,3-i][1,5]benzothiazepine is C1=CN=c2ccc3c(c2SC1)C=CN=3.
What is the InChIKey of 2H-pyrrolo[2,3-i][1,5]benzothiazepine?
The InChIKey is VVVYSWJCMCDUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-5-12-10-3-2-9-8(4-6-13-9)11(10)14-7-1/h1-6H,7H2.
What are the key properties of 2H-pyrrolo[2,3-i][1,5]benzothiazepine?
2H-pyrrolo[2,3-i][1,5]benzothiazepine has a molecular weight of 200.27 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[2,3-i][1,5]benzothiazepine is sourced from PubChem (CID 70122398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).