About CID 7012356
CID 7012356 (PubChem CID 7012356) has the molecular formula C20H22N2S2
and a molecular weight of 354.54 g/mol.
Molecular Properties
| Compound Name | CID 7012356 |
| PubChem CID | 7012356 |
| Molecular Formula | C20H22N2S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | — |
| SMILES | CC1(C)C[C@]2(C[C@@]3(C1)Nc1ccccc1S3)Nc1ccccc1S2 |
| InChI | InChI=1S/C20H22N2S2/c1-18(2)11-19(21-14-7-3-5-9-16(14)23-19)13-20(12-18)22-15-8-4-6-10-17(15)24-20/h3-10,21-22H,11-13H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | BYMVEACBOPPAJZ-PMACEKPBSA-N |
| XLogP | 6.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 7012356 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 7012356?
The IUPAC name of CID 7012356 (CID 7012356) is not available.
What is the SMILES notation for CID 7012356?
The canonical SMILES for CID 7012356 is CC1(C)C[C@]2(C[C@@]3(C1)Nc1ccccc1S3)Nc1ccccc1S2.
What is the InChIKey of CID 7012356?
The InChIKey is BYMVEACBOPPAJZ-PMACEKPBSA-N. The full InChI is InChI=1S/C20H22N2S2/c1-18(2)11-19(21-14-7-3-5-9-16(14)23-19)13-20(12-18)22-15-8-4-6-10-17(15)24-20/h3-10,21-22H,11-13H2,1-2H3/t19-,20-/m0/s1.
What are the key properties of CID 7012356?
CID 7012356 has a molecular weight of 354.54 g/mol, XLogP of 6.02, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 7012356 is sourced from PubChem (CID 7012356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).