About 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane
2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane (PubChem CID 70124161) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane |
| PubChem CID | 70124161 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane |
| SMILES | CCOC(CC(C)CCC1CC1(C)C)OCC |
| InChI | InChI=1S/C15H30O2/c1-6-16-14(17-7-2)10-12(3)8-9-13-11-15(13,4)5/h12-14H,6-11H2,1-5H3 |
| InChIKey | LFNZBRGKFCSFHT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane?
The IUPAC name of 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane (CID 70124161) is 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane?
The canonical SMILES for 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane is CCOC(CC(C)CCC1CC1(C)C)OCC.
What is the InChIKey of 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane?
The InChIKey is LFNZBRGKFCSFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-6-16-14(17-7-2)10-12(3)8-9-13-11-15(13,4)5/h12-14H,6-11H2,1-5H3.
What are the key properties of 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane?
2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane has a molecular weight of 242.40 g/mol, XLogP of 4.24, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-diethoxy-3-methylpentyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 70124161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).