About 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride
2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride (PubChem CID 70124449) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride |
| PubChem CID | 70124449 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride |
| SMILES | C1=CCC2NCNC2=C1.Cl |
| InChI | InChI=1S/C7H10N2.ClH/c1-2-4-7-6(3-1)8-5-9-7;/h1-3,7-9H,4-5H2;1H |
| InChIKey | OWNFVFIDMCTAIZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride?
The IUPAC name of 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride (CID 70124449) is 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride.
What is the SMILES notation for 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride?
The canonical SMILES for 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride is C1=CCC2NCNC2=C1.Cl.
What is the InChIKey of 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride?
The InChIKey is OWNFVFIDMCTAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.ClH/c1-2-4-7-6(3-1)8-5-9-7;/h1-3,7-9H,4-5H2;1H.
What are the key properties of 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride?
2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride has a molecular weight of 158.63 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3a,4-tetrahydro-1H-benzimidazole;hydrochloride is sourced from PubChem (CID 70124449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).