C16H21F3O2 — CID 70124656
3-(2-ethyl-1-adamantyl)-2-(trifluoromethyl)prop-2-enoic acid (PubChem CID 70124656) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-(2-ethyl-1-adamantyl)-2-(trifluoromethyl)prop-2-enoic acid.
| Compound Name | 3-(2-ethyl-1-adamantyl)-2-(trifluoromethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 70124656 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-(2-ethyl-1-adamantyl)-2-(trifluoromethyl)prop-2-enoic acid |
| SMILES | CCC1C2CC3CC(C2)CC1(C=C(C(=O)O)C(F)(F)F)C3 |
| InChI | InChI=1S/C16H21F3O2/c1-2-12-11-4-9-3-10(5-11)7-15(12,6-9)8-13(14(20)21)16(17,18)19/h8-12H,2-7H2,1H3,(H,20,21) |
| InChIKey | WCLHRIXAMSXKAK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|