C23H25N5O2 — CID 70126009
(3E)-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indol-2-one (PubChem CID 70126009) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (3E)-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3E)-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 70126009 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (3E)-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(CN3CCN(CCO)CC3)cc2/C1=C\c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C23H25N5O2/c29-11-10-27-6-8-28(9-7-27)15-16-3-4-21-19(12-16)20(23(30)26-21)13-17-14-25-22-18(17)2-1-5-24-22/h1-5,12-14,29H,6-11,15H2,(H,24,25)(H,26,30)/b20-13+ |
| InChIKey | KKNKKKJSZCNANC-DEDYPNTBSA-N |
| XLogP | 2.17 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|