About [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone
[2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone (PubChem CID 70126062) has the molecular formula C21H25NO2S
and a molecular weight of 355.50 g/mol. Its IUPAC name is [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone |
| PubChem CID | 70126062 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)c1ccccc1O[C@@H]1CCCC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C21H25NO2S/c23-21(16-11-14-25-15-16)17-7-1-3-9-19(17)24-20-10-4-2-8-18(20)22-12-5-6-13-22/h1,3,7,9,11,14-15,18,20H,2,4-6,8,10,12-13H2/t18-,20-/m1/s1 |
| InChIKey | KZHRUIYIHPNRQA-UYAOXDASSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone?
The IUPAC name of [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone (CID 70126062) is [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone.
What is the SMILES notation for [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone?
The canonical SMILES for [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone is O=C(c1ccsc1)c1ccccc1O[C@@H]1CCCC[C@H]1N1CCCC1.
What is the InChIKey of [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone?
The InChIKey is KZHRUIYIHPNRQA-UYAOXDASSA-N. The full InChI is InChI=1S/C21H25NO2S/c23-21(16-11-14-25-15-16)17-7-1-3-9-19(17)24-20-10-4-2-8-18(20)22-12-5-6-13-22/h1,3,7,9,11,14-15,18,20H,2,4-6,8,10,12-13H2/t18-,20-/m1/s1.
What are the key properties of [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone?
[2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone has a molecular weight of 355.50 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]-thiophen-3-ylmethanone is sourced from PubChem (CID 70126062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).