C14H23N3 — CID 70126913
7-(piperidin-3-ylmethyl)-1,2,3,4,8,8a-hexahydro-1,8-naphthyridine (PubChem CID 70126913) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 7-(piperidin-3-ylmethyl)-1,2,3,4,8,8a-hexahydro-1,8-naphthyridine.
| Compound Name | 7-(piperidin-3-ylmethyl)-1,2,3,4,8,8a-hexahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 70126913 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 7-(piperidin-3-ylmethyl)-1,2,3,4,8,8a-hexahydro-1,8-naphthyridine |
| SMILES | C1=C(CC2CCCNC2)NC2NCCCC2=C1 |
| InChI | InChI=1S/C14H23N3/c1-3-11(10-15-7-1)9-13-6-5-12-4-2-8-16-14(12)17-13/h5-6,11,14-17H,1-4,7-10H2 |
| InChIKey | HEHODTMVJWZXSZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |