About 4-but-1-enylisoindole-1,3-dione
4-but-1-enylisoindole-1,3-dione (PubChem CID 70126944) has the molecular formula C24H22N2O4
and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-but-1-enylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-but-1-enylisoindole-1,3-dione |
| PubChem CID | 70126944 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-but-1-enylisoindole-1,3-dione |
| SMILES | CCC=Cc1cccc2c1C(=O)NC2=O.CCC=Cc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/2C12H11NO2/c2*1-2-3-5-8-6-4-7-9-10(8)12(15)13-11(9)14/h2*3-7H,2H2,1H3,(H,13,14,15) |
| InChIKey | HAVPMGMPJFYDOA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-but-1-enylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-enylisoindole-1,3-dione?
The IUPAC name of 4-but-1-enylisoindole-1,3-dione (CID 70126944) is 4-but-1-enylisoindole-1,3-dione.
What is the SMILES notation for 4-but-1-enylisoindole-1,3-dione?
The canonical SMILES for 4-but-1-enylisoindole-1,3-dione is CCC=Cc1cccc2c1C(=O)NC2=O.CCC=Cc1cccc2c1C(=O)NC2=O.
What is the InChIKey of 4-but-1-enylisoindole-1,3-dione?
The InChIKey is HAVPMGMPJFYDOA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H11NO2/c2*1-2-3-5-8-6-4-7-9-10(8)12(15)13-11(9)14/h2*3-7H,2H2,1H3,(H,13,14,15).
What are the key properties of 4-but-1-enylisoindole-1,3-dione?
4-but-1-enylisoindole-1,3-dione has a molecular weight of 402.45 g/mol, XLogP of 3.99, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-enylisoindole-1,3-dione is sourced from PubChem (CID 70126944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).