About 3-(1-chlorobutyl)aniline
3-(1-chlorobutyl)aniline (PubChem CID 70127245) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 3-(1-chlorobutyl)aniline.
Molecular Properties
| Compound Name | 3-(1-chlorobutyl)aniline |
| PubChem CID | 70127245 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3-(1-chlorobutyl)aniline |
| SMILES | CCCC(Cl)c1cccc(N)c1 |
| InChI | InChI=1S/C10H14ClN/c1-2-4-10(11)8-5-3-6-9(12)7-8/h3,5-7,10H,2,4,12H2,1H3 |
| InChIKey | WPXZGNBKPMEUKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-chlorobutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-chlorobutyl)aniline?
The IUPAC name of 3-(1-chlorobutyl)aniline (CID 70127245) is 3-(1-chlorobutyl)aniline.
What is the SMILES notation for 3-(1-chlorobutyl)aniline?
The canonical SMILES for 3-(1-chlorobutyl)aniline is CCCC(Cl)c1cccc(N)c1.
What is the InChIKey of 3-(1-chlorobutyl)aniline?
The InChIKey is WPXZGNBKPMEUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN/c1-2-4-10(11)8-5-3-6-9(12)7-8/h3,5-7,10H,2,4,12H2,1H3.
What are the key properties of 3-(1-chlorobutyl)aniline?
3-(1-chlorobutyl)aniline has a molecular weight of 183.68 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-chlorobutyl)aniline is sourced from PubChem (CID 70127245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).