C15H20N2O4 — CID 70127253
5-amino-1-(methylcarbamoyl)cyclohexa-2,4-diene-1-carboxylic acid;2,5-dimethylfuran (PubChem CID 70127253) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-amino-1-(methylcarbamoyl)cyclohexa-2,4-diene-1-carboxylic acid;2,5-dimethylfuran.
| Compound Name | 5-amino-1-(methylcarbamoyl)cyclohexa-2,4-diene-1-carboxylic acid;2,5-dimethylfuran |
|---|---|
| PubChem CID | 70127253 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-amino-1-(methylcarbamoyl)cyclohexa-2,4-diene-1-carboxylic acid;2,5-dimethylfuran |
| SMILES | CNC(=O)C1(C(=O)O)C=CC=C(N)C1.Cc1ccc(C)o1 |
| InChI | InChI=1S/C9H12N2O3.C6H8O/c1-11-7(12)9(8(13)14)4-2-3-6(10)5-9;1-5-3-4-6(2)7-5/h2-4H,5,10H2,1H3,(H,11,12)(H,13,14);3-4H,1-2H3 |
| InChIKey | UFFYCPOEZHDHBG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|