C31H40N2O2 — CID 70127745
3-[(3R,4R)-1-[(2S)-2-[3-(4-hydroxyphenyl)propylamino]-3-phenylpropyl]-2,3-dimethylpiperidin-4-yl]phenol (PubChem CID 70127745) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is 3-[(3R,4R)-1-[(2S)-2-[3-(4-hydroxyphenyl)propylamino]-3-phenylpropyl]-2,3-dimethylpiperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-1-[(2S)-2-[3-(4-hydroxyphenyl)propylamino]-3-phenylpropyl]-2,3-dimethylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 70127745 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 3-[(3R,4R)-1-[(2S)-2-[3-(4-hydroxyphenyl)propylamino]-3-phenylpropyl]-2,3-dimethylpiperidin-4-yl]phenol |
| SMILES | CC1[C@H](C)[C@H](c2cccc(O)c2)CCN1C[C@H](Cc1ccccc1)NCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-23-24(2)33(19-17-31(23)27-11-6-12-30(35)21-27)22-28(20-26-8-4-3-5-9-26)32-18-7-10-25-13-15-29(34)16-14-25/h3-6,8-9,11-16,21,23-24,28,31-32,34-35H,7,10,17-20,22H2,1-2H3/t23-,24?,28-,31+/m0/s1 |
| InChIKey | JQPYBYONSLIEAQ-JQIHPJOFSA-N |
| XLogP | 5.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|