C17H24N2O4 — CID 70127798
6-(4-ethoxyphenyl)-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxine-6-carbohydrazide (PubChem CID 70127798) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxine-6-carbohydrazide.
| Compound Name | 6-(4-ethoxyphenyl)-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 70127798 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 6-(4-ethoxyphenyl)-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxine-6-carbohydrazide |
| SMILES | CCOc1ccc(C2(C(=O)NN)CCC3OCCOC3C2)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-2-21-13-5-3-12(4-6-13)17(16(20)19-18)8-7-14-15(11-17)23-10-9-22-14/h3-6,14-15H,2,7-11,18H2,1H3,(H,19,20) |
| InChIKey | XTEXKGGRHHWVDM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|