C26H37N5 — CID 70128482
2-(aminomethyl)-N,N-dipropyl-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine (PubChem CID 70128482) has the molecular formula C26H37N5 and a molecular weight of 419.62 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dipropyl-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine.
| Compound Name | 2-(aminomethyl)-N,N-dipropyl-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 70128482 |
| Molecular Formula | C26H37N5 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 2-(aminomethyl)-N,N-dipropyl-9-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
| SMILES | CCCN(CCC)c1nc(CN)nc2c1c1c(n2-c2c(C)cc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C26H37N5/c1-6-12-30(13-7-2)25-23-20-10-8-9-11-21(20)31(26(23)29-22(16-27)28-25)24-18(4)14-17(3)15-19(24)5/h14-15H,6-13,16,27H2,1-5H3 |
| InChIKey | CMLRDWXMKJSKEB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |