C19H14F3N5OS — CID 70128555
2-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 70128555) has the molecular formula C19H14F3N5OS and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 70128555 |
| Molecular Formula | C19H14F3N5OS |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-[5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(-c2nc3cccc4c3n2CCNC4=O)s1 |
| InChI | InChI=1S/C19H14F3N5OS/c1-26-12(9-15(25-26)19(20,21)22)13-5-6-14(29-13)17-24-11-4-2-3-10-16(11)27(17)8-7-23-18(10)28/h2-6,9H,7-8H2,1H3,(H,23,28) |
| InChIKey | AVUKYFCHHRFZLW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |